
CAS 76347-14-3
:2-[(2Z)-1,1-Dimethyl-2-buten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-[(2Z)-1,1-Dimethyl-2-buten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane ring structure, which incorporates boron and oxygen atoms. This compound features a substituted alkene moiety, specifically a 1,1-dimethyl-2-butenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of multiple methyl groups enhances its steric bulk and may influence its solubility and stability. Dioxaborolanes are known for their utility in various chemical reactions, particularly in the formation of carbon-boron bonds, making them valuable intermediates in organic synthesis and materials science. The compound's specific stereochemistry, indicated by the (2Z) configuration, suggests a particular spatial arrangement that can affect its chemical behavior and interactions. Overall, this compound exemplifies the diverse chemistry of boron compounds and their relevance in synthetic organic chemistry.
Formula:C12H23BO2
InChI:InChI=1S/C12H23BO2/c1-8-9-10(2,3)13-14-11(4,5)12(6,7)15-13/h8-9H,1-7H3/b9-8-
InChI key:InChIKey=DWUYWQRWXJRDFD-HJWRWDBZSA-N
SMILES:C(/C=C\C)(C)(C)B1OC(C)(C)C(C)(C)O1
Synonyms:- 1,3,2-Dioxaborolane, 2-(1,1-dimethyl-2-butenyl)-4,4,5,5-tetramethyl-, (Z)-
- 2-[(2Z)-1,1-Dimethyl-2-buten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[(2Z)-1,1-dimethyl-2-buten-1-yl]-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,2-Dioxaborolane, 2-[(2Z)-1,1-dimethyl-2-buten-1-yl]-4,4,5,5-tetramethyl-
CAS:Formula:C12H23BO2Molecular weight:210.1208
