
CAS 76348-84-0
:15-Deacetylneosolaniol
Description:
15-Deacetylneosolaniol is a mycotoxin produced by certain species of fungi, particularly those in the Fusarium genus. This compound is characterized by its structure, which includes a tricyclic ring system and hydroxyl groups that contribute to its biological activity. It is known for its potential toxicity, particularly in agricultural contexts, as it can contaminate crops and pose risks to animal and human health. The substance exhibits antifungal properties and can affect cellular processes, leading to various toxicological effects. Its presence in food products is a concern, prompting regulatory measures to monitor and limit exposure. Additionally, 15-Deacetylneosolaniol is studied for its role in plant-pathogen interactions and its implications in food safety and toxicology. Understanding its characteristics, including its solubility, stability, and reactivity, is crucial for assessing its environmental impact and developing strategies for mitigation in agricultural practices.
Formula:C17H24O7
InChI:InChI=1S/C17H24O7/c1-8-4-11-16(6-18,5-10(8)20)15(3)13(23-9(2)19)12(21)14(24-11)17(15)7-22-17/h4,10-14,18,20-21H,5-7H2,1-3H3/t10-,11+,12+,13+,14+,15+,16+,17-/m0/s1
InChI key:InChIKey=CSYVMZMEBKUDRQ-BNWDXEGFSA-N
SMILES:C[C@@]12[C@@]3([C@@]([C@H](O)[C@H]1OC(C)=O)(O[C@]4([C@]2(CO)C[C@H](O)C(C)=C4)[H])[H])CO3
Synonyms:- Trichothec-9-ene-3,4,8,15-tetrol, 12,13-epoxy-, 4-acetate, (3α,4β,8α)-
- 15-Deacetylneosolaniol
- Toxin NT 2
- 4-Acetoxy T-2 tetraol
- MHT 2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NT 2 Toxin
CAS:NT 2 Toxin is a useful organic compound for research related to life sciences. The catalog number is T124258 and the CAS number is 76348-84-0.
Formula:C17H24O7Color and Shape:SolidMolecular weight:340.372
