CymitQuimica logo

CAS 76350-88-4

:

Benzenemethanol, 3-amino-2-methyl-, hydrochloride (1:1)

Description:
Benzenemethanol, 3-amino-2-methyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its aromatic structure and the presence of both an amino group and a hydroxymethyl group. The compound features a benzene ring substituted with a methyl group and an amino group at specific positions, contributing to its unique reactivity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and organic synthesis. The presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Its molecular structure also suggests potential for hydrogen bonding, influencing its physical properties such as melting point and boiling point. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C8H11NO·ClH
InChI:InChI=1S/C8H11NO.ClH/c1-6-7(5-10)3-2-4-8(6)9;/h2-4,10H,5,9H2,1H3;1H
InChI key:InChIKey=VODBTCPLHMEMAS-UHFFFAOYSA-N
SMILES:C(O)C1=C(C)C(N)=CC=C1.Cl
Synonyms:
  • Benzenemethanol, 3-amino-2-methyl-, hydrochloride
  • Benzenemethanol, 3-amino-2-methyl-, hydrochloride (1:1)
  • 3-Hydroxymethyl-2-methylaniline hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.