
CAS 7636-27-3
:3,5-Dimethoxyphenylalanine
Description:
3,5-Dimethoxyphenylalanine, identified by its CAS number 7636-27-3, is an amino acid derivative characterized by the presence of two methoxy groups (-OCH3) attached to the phenyl ring at the 3 and 5 positions. This compound is a structural analog of phenylalanine, an essential amino acid, and is notable for its potential applications in biochemical research and pharmaceuticals. The methoxy substitutions can influence the compound's solubility, reactivity, and interaction with biological systems. Typically, such modifications can enhance the lipophilicity of the molecule, potentially affecting its absorption and distribution in biological contexts. The presence of the amino group (-NH2) allows it to participate in peptide bond formation, making it relevant in protein synthesis and metabolic pathways. Additionally, 3,5-Dimethoxyphenylalanine may exhibit unique pharmacological properties, which could be explored for therapeutic uses. However, detailed studies are necessary to fully understand its biological activity and potential applications in medicine or biochemistry.
Formula:C11H15NO4
InChI:InChI=1S/C11H15NO4/c1-15-8-3-7(4-9(6-8)16-2)5-10(12)11(13)14/h3-4,6,10H,5,12H2,1-2H3,(H,13,14)
InChI key:InChIKey=RGJFWLUOTAIYGQ-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)C1=CC(OC)=CC(OC)=C1
Synonyms:- Phenylalanine, 3,5-dimethoxy-
- DL-Phenylalanine, 3,5-dimethoxy-
- 3,5-Dimethoxyphenylalanine
- 2-Amino-3-(3,5-dimethoxyphenyl)propanoic acid
- Alanine, 3-(3,5-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.