CAS 76360-67-3
:Ethyl 2-phenyl-4-[(phenylmethyl)amino]-5-pyrimidinecarboxylate
Description:
Ethyl 2-phenyl-4-[(phenylmethyl)amino]-5-pyrimidinecarboxylate, with the CAS number 76360-67-3, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with an ethyl ester group and an amino group attached to a phenylmethyl moiety, contributing to its structural complexity. It is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of both aromatic and aliphatic components in its structure may influence its solubility, stability, and reactivity. Typically, compounds of this nature are evaluated for their interactions with biological targets, which can include enzymes or receptors, making them of interest in drug development. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, ethyl 2-phenyl-4-[(phenylmethyl)amino]-5-pyrimidinecarboxylate represents a significant example of how modifications to a pyrimidine core can yield compounds with diverse chemical and biological properties.
Formula:C20H19N3O2
InChI:InChI=1S/C20H19N3O2/c1-2-25-20(24)17-14-22-18(16-11-7-4-8-12-16)23-19(17)21-13-15-9-5-3-6-10-15/h3-12,14H,2,13H2,1H3,(H,21,22,23)
InChI key:InChIKey=CNDOADIUFVAYBP-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C=2C(C(OCC)=O)=CN=C(N2)C3=CC=CC=C3
Synonyms:- Ethyl 2-phenyl-4-[(phenylmethyl)amino]-5-pyrimidinecarboxylate
- 5-Pyrimidinecarboxylic acid, 2-phenyl-4-[(phenylmethyl)amino]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.