
CAS 76361-14-3
:1-(2-Methoxyethyl)-7-phenyl-2H-pyrimido[4,5-d][1,3]oxazine-2,4(1H)-dione
Description:
1-(2-Methoxyethyl)-7-phenyl-2H-pyrimido[4,5-d][1,3]oxazine-2,4(1H)-dione, with the CAS number 76361-14-3, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features a pyrimido[4,5-d][1,3]oxazine core, which is a bicyclic system that incorporates both nitrogen and oxygen atoms, contributing to its unique chemical properties. The presence of a methoxyethyl group enhances its solubility and may influence its biological activity. Additionally, the phenyl group attached to the structure can provide aromatic characteristics, potentially affecting the compound's reactivity and interaction with other molecules. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further studies, including its mechanism of action and potential therapeutic uses. As with many organic compounds, stability, solubility, and reactivity are key characteristics that would be evaluated in practical applications.
Formula:C15H13N3O4
InChI:InChI=1S/C15H13N3O4/c1-21-8-7-18-13-11(14(19)22-15(18)20)9-16-12(17-13)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3
InChI key:InChIKey=PVENCEDSKVTUAC-UHFFFAOYSA-N
SMILES:C(COC)N1C=2C(=CN=C(N2)C3=CC=CC=C3)C(=O)OC1=O
Synonyms:- 1-(2-Methoxyethyl)-7-phenyl-2H-pyrimido[4,5-d][1,3]oxazine-2,4(1H)-dione
- 1-(2-Methoxyethyl)-7-phenyl-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione
- 1-(2-Methoxyethyl)-7-phenylpyrimido[4,5-d][1,3]oxazine-2,4-dione
- 2H-Pyrimido[4,5-d][1,3]oxazine-2,4(1H)-dione, 1-(2-methoxyethyl)-7-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2-Methoxyethyl)-7-phenyl-1H-pyrimido[4,5-d][1,3]oxazine-2,4-dione
CAS:Formula:C15H13N3O4Molecular weight:299.2814
