CAS 76362-28-2
:3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)(methyl)amino]propanenitrile
Description:
3-[(4-amino-6,7-dimethoxyquinazolin-2-yl)(methyl)amino]propanenitrile, with the CAS number 76362-28-2, is a chemical compound characterized by its complex structure, which includes a quinazoline moiety and a propanenitrile group. This compound features a quinazoline ring that is substituted with amino and methoxy groups, contributing to its potential biological activity. The presence of the propanenitrile group indicates that it may exhibit properties typical of nitriles, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The methoxy groups enhance its solubility in organic solvents and may influence its pharmacological properties. Compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development, due to their ability to interact with biological targets. Overall, the unique combination of functional groups in this compound suggests a diverse range of chemical reactivity and potential biological significance.
Formula:C14H17N5O2
InChI:InChI=1/C14H17N5O2/c1-19(6-4-5-15)14-17-10-8-12(21-3)11(20-2)7-9(10)13(16)18-14/h7-8H,4,6H2,1-3H3,(H2,16,17,18)
SMILES:CN(CCC#N)c1nc2cc(c(cc2c(=N)[nH]1)OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(4-Amino-6,7-dimethoxyquinazol-2-yl)-N-methyl-2-cyanoethylamine
CAS:Formula:C14H17N5O2Molecular weight:287.32
