CAS 76375-60-5
:D-Galactosamine pentaacetate
Description:
D-Galactosamine pentaacetate is a derivative of D-galactosamine, an amino sugar that plays a significant role in various biological processes. This compound is characterized by the presence of five acetyl groups attached to the galactosamine molecule, which enhances its solubility and stability. It typically appears as a white to off-white crystalline powder and is soluble in organic solvents such as methanol and ethanol, but less soluble in water due to the acetylation. D-Galactosamine pentaacetate is often used in biochemical research, particularly in studies involving glycoproteins and cell signaling pathways. Its acetyl groups can influence the reactivity and interaction of the molecule with other biological entities. Additionally, this compound may serve as a useful intermediate in organic synthesis and pharmaceutical applications. As with many chemical substances, proper handling and safety precautions should be observed, as it may exhibit biological activity that necessitates careful study in laboratory settings.
Formula:C16H33NO15
InChI:InChI=1/C6H13NO5.5C2H4O2/c7-3-5(10)4(9)2(1-8)12-6(3)11;5*1-2(3)4/h2-6,8-11H,1,7H2;5*1H3,(H,3,4)/t2-,3-,4+,5-,6?;;;;;/m1...../s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
D-Galactosamine pentaacetate
CAS:Formula:C16H23NO10Purity:97%Color and Shape:SolidMolecular weight:389.3545(3R,4R,5R,6R)-3-Acetamido-6-(acetoxymethyl)tetrahydro-2H-pyran-2,4,5-triyl triacetate
CAS:Formula:C16H23NO10Purity:95%Color and Shape:SolidMolecular weight:389.357D-Galactosamine pentaacetate
CAS:D-Galactosamine pentaacetateFormula:C16H23NO10Purity:By hplc: >95% (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:389.35g/mol2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-D-galactopyranose
CAS:<p>2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-D-galactopyranose is fully acetylated D-Galactosamine (C4 epimer of D-Glucosamine). 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-D-galactopyranose is used in the synthesis of α- and β-linked acetamido pyranosides, which have anti-inflammatory properties as inhibitors of TLR4.</p>Formula:C16H23NO10Purity:Min. 95%Color and Shape:White PowderMolecular weight:389.35 g/mol2-Acetamido-2-deoxy-D-galactopyranose-1,3,4,6-tetra-O-acetate
CAS:Controlled ProductFormula:C16H23NO10Color and Shape:NeatMolecular weight:389.35





