CymitQuimica logo

CAS 76385-49-4

:

5-fluoro-4-oxopentanoic acid

Description:
5-Fluoro-4-oxopentanoic acid is an organic compound characterized by the presence of a fluorine atom, a ketone functional group, and a carboxylic acid group within its structure. The molecular formula typically reflects a five-carbon chain, with the fluorine substituent located at the fifth carbon and the ketone group at the fourth carbon. This compound is likely to exhibit acidic properties due to the carboxylic acid group, which can donate protons in solution. The presence of the fluorine atom may influence its reactivity and biological activity, potentially enhancing lipophilicity or altering metabolic pathways. Additionally, the compound may be of interest in pharmaceutical research, particularly in the development of fluorinated compounds that can exhibit unique biological properties. Its solubility in polar solvents is expected due to the carboxylic acid functionality, while the overall stability and reactivity can be influenced by the specific arrangement of functional groups. As with many organic acids, it may participate in various chemical reactions, including esterification and amidation.
Formula:C5H7FO3
InChI:InChI=1/C5H7FO3/c6-3-4(7)1-2-5(8)9/h1-3H2,(H,8,9)
SMILES:C(CC(=O)O)C(=O)CF
Synonyms:
  • Pentanoic Acid, 5-Fluoro-4-Oxo-
  • 5-Fluoro-4-oxopentanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.