CAS 76386-09-9

3-[(1E)-dec-1-en-1-yl]dihydrofuran-2,5-dione

Description:

3-[(1E)-dec-1-en-1-yl]dihydrofuran-2,5-dione, with the CAS number 76386-09-9, is an organic compound characterized by its unique structure, which includes a dihydrofuran ring and a dec-1-en-1-yl substituent. This compound features a conjugated system that may contribute to its reactivity and potential applications in organic synthesis or as a building block in the development of more complex molecules. The presence of the diene functionality suggests that it may participate in various chemical reactions, such as Diels-Alder reactions or polymerization processes. Additionally, the dihydrofuran moiety is known for its role in various biological activities, which may indicate potential pharmacological properties. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 3-[(1E)-dec-1-en-1-yl]dihydrofuran-2,5-dione represents a versatile structure in organic chemistry, with implications for both synthetic and biological applications.

Formula: C₁₄H₂₂O₃

InChI: InChI=1/C14H22O3/c1-2-3-4-5-6-7-8-9-10-12-11-13(15)17-14(12)16/h9-10,12H,2-8,11H2,1H3/b10-9+

Synonyms:

• 2,5-Furandione, 3-(decenyl)dihydro-
• 2-Decenylsuccinic anhydride
• 3-(Decenyl)Dihydrofuran-2,5-Dione