CAS 763863-61-2

[3-(morpholin-4-ylmethyl)phenyl](phenyl)methanone

Description:

The chemical substance known as [3-(morpholin-4-ylmethyl)phenyl](phenyl)methanone, with the CAS number 763863-61-2, is characterized by its complex molecular structure, which includes a phenyl group and a morpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in medicinal chemistry and material science. The presence of the morpholine ring suggests that it may possess good solubility in polar solvents and could interact favorably with biological targets, making it of interest in drug development. Additionally, the ketone functional group in its structure may impart reactivity that can be exploited in various chemical reactions. The compound's stability, melting point, and boiling point would depend on its specific molecular interactions and the environment in which it is studied. Overall, this substance represents a class of compounds that may have significant implications in pharmaceutical research and development due to its unique structural features.

Formula: C₁₈H₁₉NO₂

InChI: InChI=1/C18H19NO2/c20-18(16-6-2-1-3-7-16)17-8-4-5-15(13-17)14-19-9-11-21-12-10-19/h1-8,13H,9-12,14H2

SMILES: c1ccc(cc1)C(=O)c1cccc(c1)CN1CCOCC1

3-(morpholinomethyl)benzophenone

CAS: 763863-61-2

Formula: C₁₈H₁₉NO₂

Purity: 95.0%

Molecular weight: 281.355

Ref: 10-F204654