CymitQuimica logo

CAS 76391-21-4

:

2-Oxo-3-phenoxypropanoic acid

Description:
2-Oxo-3-phenoxypropanoic acid, with the CAS number 76391-21-4, is an organic compound characterized by its unique structure, which includes a phenoxy group and a keto acid functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the phenoxy moiety. It possesses a carboxylic acid functional group, which contributes to its acidity and reactivity in various chemical reactions, such as esterification and amidation. The presence of the keto group enhances its reactivity, making it a potential intermediate in organic synthesis. Additionally, 2-oxo-3-phenoxypropanoic acid may exhibit biological activity, which could be of interest in pharmaceutical applications. Its stability under standard conditions is generally good, but it should be handled with care due to potential reactivity with strong bases or nucleophiles. Overall, this compound serves as a valuable building block in synthetic organic chemistry and may have applications in medicinal chemistry and agrochemicals.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c10-8(9(11)12)6-13-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)
InChI key:InChIKey=RSUOYCBRWUTZAO-UHFFFAOYSA-N
SMILES:O(CC(C(O)=O)=O)C1=CC=CC=C1
Synonyms:
  • Phenoxypyruvic acid
  • Propanoic acid, 2-oxo-3-phenoxy-
  • 2-Oxo-3-phenoxypropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.