CymitQuimica logo

CAS 76391-34-9

:

L-Proline, 1-[N-[1-(butoxycarbonyl)-3-phenylpropyl]-L-alanyl]-, (S)-

Description:
L-Proline, 1-[N-[1-(butoxycarbonyl)-3-phenylpropyl]-L-alanyl]-, (S)-, with CAS number 76391-34-9, is a synthetic amino acid derivative characterized by its unique structure that includes a proline backbone and a butoxycarbonyl protecting group. This compound is typically used in peptide synthesis and as a building block in the development of pharmaceuticals due to its ability to form stable peptide bonds. The presence of the phenylpropyl group enhances its hydrophobic characteristics, which can influence solubility and interaction with biological membranes. As an (S)-enantiomer, it exhibits specific stereochemical properties that are crucial for its biological activity. The butoxycarbonyl group serves as a protective moiety, allowing for selective reactions during synthesis. Overall, this compound is significant in medicinal chemistry and biochemistry, particularly in the design of bioactive peptides and drug candidates. Its stability, reactivity, and stereochemistry make it a valuable tool in various chemical and biological applications.
Formula:C22H32N2O5
InChI:InChI=1S/C22H32N2O5/c1-3-4-15-29-22(28)18(13-12-17-9-6-5-7-10-17)23-16(2)20(25)24-14-8-11-19(24)21(26)27/h5-7,9-10,16,18-19,23H,3-4,8,11-15H2,1-2H3,(H,26,27)/t16-,18-,19-/m0/s1
InChI key:InChIKey=ANOQNYRWFAERCM-WDSOQIARSA-N
SMILES:C([C@@H](N[C@@H](CCC1=CC=CC=C1)C(OCCCC)=O)C)(=O)N2[C@H](C(O)=O)CCC2
Synonyms:
  • L-Proline, 1-[N-[1-(butoxycarbonyl)-3-phenylpropyl]-L-alanyl]-, (S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.