CymitQuimica logo

CAS 763925-38-8

:

4-chloro-2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

Description:
4-Chloro-2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. The presence of a chloro group and a trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically a solid at room temperature and exhibits stability under standard conditions, although it may be sensitive to moisture and light. Its unique structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its ability to form hydrogen bonds and engage in π-π stacking interactions. Additionally, the trifluoromethyl group can enhance metabolic stability and bioavailability. As with many fluorinated compounds, it may exhibit distinct solubility characteristics, making it of interest in various chemical and pharmaceutical applications. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks.
Formula:C8H7ClF3N3
InChI:InChI=1/C8H7ClF3N3/c9-6-4-1-2-13-3-5(4)14-7(15-6)8(10,11)12/h13H,1-3H2
SMILES:C1CNCc2c1c(Cl)nc(C(F)(F)F)n2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.