CAS 764-09-0
:2,2,2-trichloroethyl chlorosulfate
Description:
2,2,2-Trichloroethyl chlorosulfate, with the CAS number 764-09-0, is an organosulfur compound characterized by its chlorinated and sulfonated functional groups. It appears as a colorless to pale yellow liquid and is known for its strong reactivity, particularly as a chlorinating agent. The presence of multiple chlorine atoms contributes to its high density and volatility, making it a potent reagent in organic synthesis. This compound is typically used in the production of various chemicals, including pharmaceuticals and agrochemicals, due to its ability to introduce chlorosulfate groups into organic molecules. However, it is also recognized for its potential hazards; it can be corrosive and poses risks of skin and respiratory irritation. Proper handling and storage in a controlled environment are essential to mitigate these risks. Additionally, due to its environmental impact, it is subject to regulatory scrutiny, necessitating adherence to safety protocols during its use and disposal.
Formula:C2H2Cl4O3S
InChI:InChI=1/C2H2Cl4O3S/c3-2(4,5)1-9-10(6,7)8/h1H2
SMILES:C(C(Cl)(Cl)Cl)OS(=O)(=O)Cl
Synonyms:- 2,2,2-Trichloroethanol Chlorosulfate
- 2,2,2-Trichloroethyl Chlorosulfate
- 2,2,2-Trichloroethylsulfonylchloride
- Chlorosulfuric Acid 2,2,2-Trichloroethyl Ester
- 1,1-trichloro-2-chlorosulfonyloxyethane
- 3,3,3-Trichloroethyl Chlorosulfate
- 2,2,2-Trichloroethyl sulfurochloridate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,2,2-trichloroethyl chloranesulfonate
CAS:Formula:C2H2Cl4O3SPurity:95%Color and Shape:LiquidMolecular weight:247.9125Ref: IN-DA0036P3
1g188.00€5g354.00€10g567.00€25gTo inquire100gTo inquire250gTo inquire500gTo inquire100mg82.00€250mg120.00€2,2,2-trichloroethoxysulfonyl chloride
CAS:2,2,2-trichloroethoxysulfonyl chlorideFormula:C2H2Cl4O3SPurity:>98% (1h-nmr) (Typical Value in Batch COA)Color and Shape: colourless liquidMolecular weight:247.91g/mol2,2,2-Trichloroethyl Chlorosulfate
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications An alkyl chlorosulfate derivative.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Ueki, M., et al.: Bioorg. Med. Chem., 9, 487 (2001), Gunnarsson, G., et al.: J. Med. Chem., 45, 4460 (2002), Howarth, N., et al.: Biochemistry, 41, 14801 (2002),<br></p>Formula:C2H2Cl4O4SColor and Shape:NeatMolecular weight:263.912,2,2-Trichloroethyl Chlorosulfate
CAS:<p>2,2,2-Trichloroethyl chlorosulfate is an organic compound that has a hydroxyl group and a chlorine in its structure. It is cytotoxic to cells and causes health effects in humans. This compound binds to the p-coumaric acid in the cell and inhibits the enzyme activity of the demethylase, which is responsible for the oxidation of p-coumaric acid to ferulic acid. This prevents p-coumaric acid from being converted into other metabolites such as dihydroferulic acid and dihydrocaffeic acid. 2,2,2-Trichloroethyl chlorosulfate also inhibits enzymes involved in the synthesis of cholesterol by competitively inhibiting HMG CoA reductase.</p>Formula:C2H2Cl4O3SPurity:Min. 95%Molecular weight:247.91 g/mol



