CAS 764-52-3
:S-(Trifluoromethyl)-L-homocysteine
Description:
S-(Trifluoromethyl)-L-homocysteine, with the CAS number 764-52-3, is an amino acid derivative characterized by the presence of a trifluoromethyl group attached to the sulfur atom of the homocysteine structure. This compound is a sulfur-containing amino acid, which is a crucial intermediate in various biochemical pathways, particularly in the metabolism of sulfur-containing compounds. The trifluoromethyl group enhances the lipophilicity and stability of the molecule, potentially influencing its biological activity and interactions. S-(Trifluoromethyl)-L-homocysteine may exhibit unique properties compared to its non-fluorinated counterparts, including altered reactivity and solubility. It is of interest in medicinal chemistry and biochemistry for its potential roles in drug design and as a biochemical probe. As with many amino acid derivatives, it may participate in various physiological processes, including protein synthesis and cellular signaling. However, specific applications and effects would depend on further research and context within biological systems.
Formula:C5H8F3NO2S
InChI:InChI=1S/C5H8F3NO2S/c6-5(7,8)12-2-1-3(9)4(10)11/h3H,1-2,9H2,(H,10,11)/t3-/m0/s1
InChI key:InChIKey=YLJLTSVBCXYTQK-VKHMYHEASA-N
SMILES:C(C[C@@H](C(O)=O)N)SC(F)(F)F
Synonyms:- S-Trifluoromethyl-L-homocysteine
- L-Homocysteine, S-(trifluoromethyl)-
- Butyric acid, 2-amino-4-[(trifluoromethyl)thio]-, (S)-
- Butyric acid, 2-amino-4-[(trifluoromethyl)thio]-
- S-(Trifluoromethyl)-L-homocysteine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Homocysteine, S-(trifluoromethyl)-
CAS:Formula:C5H8F3NO2SPurity:95%Color and Shape:SolidMolecular weight:203.1827s-(Trifluoromethyl)-l-homocysteine
CAS:s-(Trifluoromethyl)-l-homocysteinePurity:98%Molecular weight:203.18g/molS-(Trifluoromethyl)-L-homocysteine
CAS:<p>S-(trifluoromethyl)-L-homocysteine is a chemical compound that belongs to the group of antimicrobial agents. It is an inhibitor of bacterial growth and can be used to treat infectious diseases caused by bacteria. S-(Trifluoromethyl)-L-homocysteine inhibits the synthesis of methionine by binding to corynebacterium glutamicum and preventing the formation of methionine from homocysteine. This compound has shown structural analysis in wild-type strains and synthetase mutations, which have revealed its hydrogen bonding interactions with trifluoroacetic acid and ph optimum. Chemical stability has also been demonstrated for this compound in the presence of various acids, bases, alcohols, and oxidizing agents.</p>Formula:C5H8F3NO2SPurity:Min. 95%Color and Shape:White PowderMolecular weight:203.18 g/mol(S)-2-Amino-4-((trifluoromethyl)thio)butanoic acid
CAS:Formula:C5H8F3NO2SPurity:95%Molecular weight:203.18




