CymitQuimica logo

CAS 76407-98-2

:

3-methyl-1-phenyl-1H-pyrazol-5-yl hydrogen sulfate

Description:
3-Methyl-1-phenyl-1H-pyrazol-5-yl hydrogen sulfate, with the CAS number 76407-98-2, is an organic compound that features a pyrazole ring substituted with a methyl group and a phenyl group, along with a hydrogen sulfate functional group. This compound typically exhibits characteristics common to pyrazole derivatives, such as potential biological activity and reactivity due to the presence of the hydrogen sulfate moiety, which can act as a leaving group in various chemical reactions. The presence of the methyl and phenyl groups can influence its solubility, stability, and interaction with other molecules. Generally, compounds like this may be of interest in medicinal chemistry and materials science due to their unique structural features and potential applications. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety data should also be consulted, as the hydrogen sulfate group can impart corrosive properties.
Formula:C10H10N2O4S
InChI:InChI=1/C10H10N2O4S/c1-8-7-10(16-17(13,14)15)12(11-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14,15)
SMILES:Cc1cc(n(c2ccccc2)n1)OS(=O)(=O)O
Synonyms:
  • 1H-Pyrazol-5-ol, 3-methyl-1-phenyl-, hydrogen sulfate (ester)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.