CAS 76409-26-2
:alpha-(fluoromethyl)-2,3-dihydroxy-L-phenylalanine
Description:
Alpha-(fluoromethyl)-2,3-dihydroxy-L-phenylalanine, with the CAS number 76409-26-2, is a synthetic amino acid derivative that features a fluoromethyl group and two hydroxyl groups on the phenylalanine backbone. This compound is characterized by its potential biological activity, particularly in the context of neurotransmitter modulation and as a precursor in various biochemical pathways. The presence of the fluoromethyl group may enhance its lipophilicity and influence its interaction with biological targets, potentially affecting its pharmacological properties. The dihydroxy substitution indicates that it may participate in hydrogen bonding, which can affect its solubility and reactivity. Additionally, the stereochemistry of the L-phenylalanine backbone is crucial for its biological activity, as it may interact with specific receptors or enzymes in a stereospecific manner. Overall, this compound's unique structural features suggest it could have applications in medicinal chemistry and drug development, particularly in the design of compounds targeting neurological disorders.
Formula:C10H12FNO4
InChI:InChI=1/C10H12FNO4/c11-5-10(12,9(15)16)4-6-2-1-3-7(13)8(6)14/h1-3,13-14H,4-5,12H2,(H,15,16)/t10-/m1/s1
SMILES:c1cc(C[C@@](CF)(C(=O)O)N)c(c(c1)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.