CAS 7641-77-2
:1,2,3,4,5,6-Hexamethylbicyclo[2.2.0]hexa-2,5-diene
Description:
1,2,3,4,5,6-Hexamethylbicyclo[2.2.0]hexa-2,5-diene, with the CAS number 7641-77-2, is a bicyclic organic compound characterized by its unique structure, which features a bicyclo[2.2.0] framework and multiple methyl substituents. This compound is notable for its diene functionality, which allows it to participate in various chemical reactions, particularly those involving electrophilic addition or polymerization. The presence of six methyl groups contributes to its steric bulk and can influence its reactivity and stability. Typically, compounds of this nature exhibit low volatility and may have limited solubility in polar solvents due to their hydrophobic nature. Additionally, the bicyclic structure can impart rigidity, affecting the compound's conformational properties. While specific applications may vary, compounds with similar structures are often explored in materials science and organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H18
InChI:InChI=1S/C12H18/c1-7-8(2)12(6)10(4)9(3)11(7,12)5/h1-6H3
InChI key:InChIKey=RVNQQZMIWZPGNA-UHFFFAOYSA-N
SMILES:CC12C(C)(C(C)=C1C)C(C)=C2C
Synonyms:- 1,2,3,4,5,6-Hexamethylbicyclo(2,2,0)Hexa-2,5-Diene
- 1,2,3,4,5,6-Hexamethylbicyclo[2.2.0]hexa-2,5-diene
- Bicyclo[2.2.0]hexa-2,5-diene, 1,2,3,4,5,6-hexamethyl-
- Bicyclo[2.2.0]hexa-2,5-diene, hexamethyl-
- Hexamethylbicyclo[2.2.0]hexa-2,5-diene
- Hexamethyl Dewar benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.