
CAS 76410-59-8
:L-Phenylalanine, 4-borono-, hydrochloride
Description:
L-Phenylalanine, 4-borono-, hydrochloride is a chemical compound that serves as an important intermediate in various biochemical applications, particularly in the synthesis of pharmaceuticals and as a building block in peptide synthesis. It is a derivative of the amino acid phenylalanine, featuring a boronic acid group at the para position of the phenyl ring, which enhances its reactivity in certain chemical reactions, such as Suzuki coupling. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which typically improves its solubility in water and stability. This compound is often utilized in research settings, particularly in studies involving amino acid metabolism and in the development of boron-containing compounds for medicinal chemistry. Its molecular structure includes both an amino group and a carboxylic acid group, characteristic of amino acids, allowing it to participate in various biochemical pathways. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H12BNO4·ClH
InChI:InChI=1S/C9H12BNO4.ClH/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15;/h1-4,8,14-15H,5,11H2,(H,12,13);1H/t8-;/m0./s1
InChI key:InChIKey=ITAYDCRFNXQNBL-QRPNPIFTSA-N
SMILES:C([C@@H](C(O)=O)N)C1=CC=C(B(O)O)C=C1.Cl
Synonyms:- L-Phenylalanine, 4-borono-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

