CAS 76412-62-9
:6-butoxy-5H-purin-2-amine
Description:
6-Butoxy-5H-purin-2-amine, with the CAS number 76412-62-9, is a purine derivative characterized by its structural features that include a butoxy group and an amino group attached to the purine ring system. This compound typically exhibits properties common to purines, such as being a heterocyclic aromatic compound. It is likely to be soluble in polar organic solvents due to the presence of the butoxy group, which enhances its solubility profile. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with biological molecules. As a purine analog, it may exhibit biological activity, potentially acting as a nucleoside or nucleotide mimic, which could have implications in pharmacology or biochemistry. The compound's stability, reactivity, and potential applications would depend on its specific molecular interactions and the conditions under which it is used. Overall, 6-butoxy-5H-purin-2-amine represents a class of compounds that are of interest in medicinal chemistry and biochemistry for their structural and functional properties.
Formula:C9H13N5O
InChI:InChI=1/C9H13N5O/c1-2-3-4-15-8-6-7(12-5-11-6)13-9(10)14-8/h5-6H,2-4H2,1H3,(H2,10,11,12,13)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.