CAS 76413-89-3
:5-methoxy-1,3-dihydro-2H-inden-2-one
Description:
5-Methoxy-1,3-dihydro-2H-inden-2-one, with the CAS number 76413-89-3, is an organic compound characterized by its unique bicyclic structure, which includes a methoxy group and a ketone functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly as a building block for more complex molecules. The presence of the methoxy group enhances its reactivity and solubility in organic solvents. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in pharmacology. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Overall, 5-methoxy-1,3-dihydro-2H-inden-2-one is a versatile compound with significant implications in various chemical research fields.
Formula:C10H10O2
InChI:InChI=1/C10H10O2/c1-12-10-3-2-7-4-9(11)5-8(7)6-10/h2-3,6H,4-5H2,1H3
SMILES:COc1ccc2CC(=O)Cc2c1
Synonyms:- 2H-inden-2-one, 1,3-dihydro-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
