CAS 76419-97-1

6-Isoquinolinol,1,2,3,4-tetrahydro-7-methoxy-1-methyl-

Description:

6-Isoquinolinol, 1,2,3,4-tetrahydro-7-methoxy-1-methyl- is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound consisting of a benzene ring fused to a pyridine ring. This specific compound features a tetrahydroisoquinoline framework, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a methoxy group (-OCH3) at the 7-position and a methyl group (-CH3) at the 1-position contributes to its unique chemical properties and potential biological activity. Such compounds often exhibit interesting pharmacological effects, making them of interest in medicinal chemistry. The molecular structure suggests that it may participate in various chemical reactions typical of isoquinoline derivatives, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its interactions in biological systems or its utility in synthetic applications.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1S/C11H15NO2/c1-7-9-6-11(14-2)10(13)5-8(9)3-4-12-7/h5-7,12-13H,3-4H2,1-2H3

SMILES: CC1c2cc(c(cc2CCN1)O)OC

Synonyms:

• 1-Methyl-6-hydroxy-7-methoxy-1,2,3,4-tetrahydroisoquinoline
• 7-Methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-ol
• 1,2,3,4-tetrahydro-7-Methoxy-1-Methyl-6-Isoquinolinol