
CAS 76420-74-1
:N-[(1R)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline
Description:
N-[(1R)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline, with the CAS number 76420-74-1, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a complex structure characterized by the presence of both L-alanine and L-proline, which are naturally occurring amino acids. The ethoxycarbonyl group contributes to its reactivity and solubility properties, making it potentially useful in various chemical applications, including pharmaceuticals and peptide synthesis. The phenylpropyl moiety adds hydrophobic characteristics, which can influence the compound's interaction with biological systems. Typically, compounds like this may exhibit specific biological activities, such as antimicrobial or anti-inflammatory effects, depending on their structural configuration and functional groups. Additionally, the stereochemistry indicated by the (1R) designation suggests that the compound has a specific spatial arrangement, which is crucial for its biological activity and interaction with receptors or enzymes. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry and biochemistry.
Formula:C20H28N2O5
InChI:InChI=1S/C20H28N2O5/c1-3-27-20(26)16(12-11-15-8-5-4-6-9-15)21-14(2)18(23)22-13-7-10-17(22)19(24)25/h4-6,8-9,14,16-17,21H,3,7,10-13H2,1-2H3,(H,24,25)/t14-,16+,17-/m0/s1
InChI key:InChIKey=GBXSMTUPTTWBMN-UAGQMJEPSA-N
SMILES:C([C@@H](N[C@H](CCC1=CC=CC=C1)C(OCC)=O)C)(=O)N2[C@H](C(O)=O)CCC2
Synonyms:- L-Proline, N-[(1R)-1-(ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-
- L-Proline, 1-[N-[1-(ethoxycarbonyl)-3-phenylpropyl]-L-alanyl]-, (R)-
- N-[(1R)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Enalapril EP Impurity A ((S,S,R)-Enalapril)
CAS:Formula:C20H28N2O5Color and Shape:Pale Yellow SolidMolecular weight:376.45

