CAS 76439-45-7
:3-chloro-1-hydroxy-4-nitro-pyridine
Description:
3-Chloro-1-hydroxy-4-nitro-pyridine, with the CAS number 76439-45-7, is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a chlorine atom, a hydroxyl group, and a nitro group. This compound typically exhibits a pale yellow to brownish color and is soluble in polar organic solvents. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the nitro group can enhance its reactivity and polarity. The chlorine atom introduces additional electrophilic characteristics, making it useful in various chemical reactions, including nucleophilic substitutions. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its chemical properties, such as reactivity and stability, can be influenced by the specific functional groups attached to the pyridine ring, making it a subject of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as it may pose health risks.
Formula:C5H3ClN2O3
InChI:InChI=1/C5H3ClN2O3/c6-4-3-7(9)2-1-5(4)8(10)11/h1-3H
SMILES:c1cn(=O)cc(c1N(=O)=O)Cl
Synonyms:- 3-Chloro-4-nitropyridine 1-oxide
- Pyridine, 3-Chloro-4-Nitro-, 1-Oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Chloro-4-nitropyridine N-oxide
CAS:Formula:C5H3ClN2O3Purity:95%Color and Shape:SolidMolecular weight:174.54193-Chloro-4-nitropyridine n-oxide
CAS:3-Chloro-4-nitropyridine n-oxidePurity:97%Molecular weight:174.54g/mol3-Chloro-4-nitropyridine N-oxide
CAS:Formula:C5H3ClN2O3Purity:95%Color and Shape:SolidMolecular weight:174.543-Chloro-4-nitropyridine 1-oxide
CAS:3-Chloro-4-nitropyridine 1-oxide is the condensation product of 2-chloro-3-nitropyridine and nitric acid. 3-Chloro-4-nitropyridine 1-oxide has an isomeric nature and can be purified by recrystallization from water. The compound has a molecular weight of 286.1 g/mol and a monoclinic crystal structure. It has two n-oxides, which are isomers of each other, with nmr spectra that differ by the shift in the chemical shifts of the protons on the aromatic ring. 3-Chloro-4-nitropyridine 1-oxide condenses with lanthanides to form lanthanide complexes, such as Eu(III)(3,5'-ClO 4 ) 2 . This compound is also used in the synthesis of phenoxathiine derivatives that have antihypertensive activity.
Formula:C5H3ClN2O3Purity:Min. 95%Molecular weight:174.54 g/mol



