CAS 7645-95-6

3-(2-hydroxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one

Description:

The chemical substance known as 3-(2-hydroxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one, with the CAS number 7645-95-6, is a type of chalcone, which is a class of compounds characterized by the presence of a conjugated double bond system between two aromatic rings. This specific chalcone features a hydroxyl group (-OH) on one of the aromatic rings, contributing to its potential for hydrogen bonding and influencing its solubility and reactivity. The presence of a methyl group on the para position of the other aromatic ring enhances its lipophilicity. Chalcones are known for their diverse biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. The compound's structure allows for various chemical reactions, such as oxidation and reduction, making it of interest in synthetic organic chemistry. Additionally, its unique properties may be explored in fields such as pharmaceuticals and materials science, where its potential applications could be further investigated.

Formula: C₁₆H₁₄O₂

InChI: InChI=1/C16H14O2/c1-12-6-8-14(9-7-12)16(18)11-10-13-4-2-3-5-15(13)17/h2-11,17H,1H3

SMILES: Cc1ccc(cc1)C(=O)C=Cc1ccccc1O

(2E)-3-(2-Hydroxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one

CAS: 7645-95-6

(2E)-3-(2-Hydroxyphenyl)-1-(4-methylphenyl)prop-2-en-1-one

Purity: ≥95%

Molecular weight: 238.28g/mol

Ref: 54-OR311035