CAS 76455-82-8
:2-({(2S,3S,6R,8S,9R,11R)-8-[(2R)-1-(4-bromo-1H-pyrrol-2-yl)-1-oxopropan-2-yl]-3,9,11-trimethyl-1,7-dioxaspiro[5.5]undec-2-yl}methyl)-5-(methylamino)-1,3-benzoxazole-4-carboxylate
Description:
The chemical substance with the name "2-({(2S,3S,6R,8S,9R,11R)-8-[(2R)-1-(4-bromo-1H-pyrrol-2-yl)-1-oxopropan-2-yl]-3,9,11-trimethyl-1,7-dioxaspiro[5.5]undec-2-yl}methyl)-5-(methylamino)-1,3-benzoxazole-4-carboxylate" and CAS number 76455-82-8 is a complex organic compound characterized by its intricate molecular structure, which includes multiple stereocenters and functional groups. This compound features a benzoxazole moiety, which is known for its biological activity, and a spirocyclic structure that contributes to its three-dimensional conformation. The presence of a bromo substituent on the pyrrole ring enhances its reactivity and potential interactions in biological systems. Additionally, the methylamino and carboxylate groups suggest potential for solubility in polar solvents and interactions with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. Its complexity and specific stereochemistry are crucial for its biological activity and efficacy.
Formula:C29H35BrN3O6
InChI:InChI=1/C29H36BrN3O6/c1-14-8-9-29(16(3)10-15(2)27(39-29)17(4)26(34)20-11-18(30)13-32-20)38-22(14)12-23-33-25-21(37-23)7-6-19(31-5)24(25)28(35)36/h6-7,11,13-17,22,27,31-32H,8-10,12H2,1-5H3,(H,35,36)/p-1/t14-,15+,16+,17-,22-,27-,29+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
23-Bromo-A-23187
CAS:Controlled ProductApplications Antibiotic A-23187, 23-Bromo-A-23187 is a very selective calcium ionophore.
Formula:C29H36BrN3O6Color and Shape:NeatMolecular weight:602.5174-Bromo-A23187
CAS:4-Bromo-A23187 is a medicinal compound that has been shown to inhibit kinases in human cancer cells. It is an analog of A23187, which is a calcium ionophore that induces apoptosis in tumor cells. 4-Bromo-A23187 has been found to be an effective inhibitor of protein kinases, which are enzymes that play a critical role in cell signaling pathways and the regulation of cellular processes. This compound has been studied for its potential as an anticancer agent due to its ability to induce apoptosis in cancer cells. Additionally, it has been found in the urine of Chinese individuals and may have therapeutic applications for the treatment of various diseases. Overall, 4-Bromo-A23187 shows promise as a potent inhibitor with potential therapeutic benefits for treating cancer and other diseases.Formula:C29H36BrN3O6Purity:Min. 95%Molecular weight:602.5 g/mol

