CAS 76455-84-0
:2-(Methylthio)-4(5H)-pyrimidinone
Description:
2-(Methylthio)-4(5H)-pyrimidinone, with the CAS number 76455-84-0, is a heterocyclic organic compound characterized by a pyrimidinone ring structure that incorporates a methylthio group. This compound typically exhibits properties associated with pyrimidine derivatives, such as being a polar, water-soluble substance due to the presence of the carbonyl and nitrogen atoms in the ring. The methylthio group contributes to its unique reactivity and potential biological activity, making it of interest in pharmaceutical and agricultural chemistry. The compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the electron-donating nature of the methylthio group. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of antimicrobial or antiviral agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application.
Formula:C5H6N2OS
InChI:InChI=1S/C5H6N2OS/c1-9-5-6-3-2-4(8)7-5/h3H,2H2,1H3
InChI key:InChIKey=NGNHEBHDAMZDFA-UHFFFAOYSA-N
SMILES:S(C)C1=NC(=O)CC=N1
Synonyms:- 2-(Methylthio)-4(5H)-pyrimidinone
- 4(5H)-Pyrimidinone, 2-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
