CymitQuimica logo

CAS 764600-87-5

:

1H-indole-3-carboxamidine

Description:
1H-Indole-3-carboxamidine, with the CAS number 764600-87-5, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a carboxamidine functional group, which is characterized by the presence of a carbonyl group (C=O) adjacent to an amine (NH2) group. The presence of these functional groups imparts unique chemical reactivity and potential biological activity. 1H-Indole-3-carboxamidine is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The compound is typically solid at room temperature and may exhibit solubility in polar solvents. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific formulation. As with many indole derivatives, it may also exhibit fluorescence and other optical properties, making it of interest in various fields of research, including biochemistry and material science.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5,12H,(H3,10,11)
SMILES:c1ccc2c(c1)c(c[nH]2)C(=N)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.