CAS 764633-91-2

β-Methyl-1-piperidinepropanoic acid

Description:

β-Methyl-1-piperidinepropanoic acid, identified by its CAS number 764633-91-2, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a propanoic acid moiety, contributing to its acidic properties. The presence of a methyl group at the beta position relative to the nitrogen atom influences its steric and electronic characteristics, potentially affecting its reactivity and interactions with biological systems. β-Methyl-1-piperidinepropanoic acid is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being soluble in polar solvents due to the presence of the carboxylic acid functional group. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its structural similarity to various biologically active compounds. As with many organic acids, it may exhibit both acidic and basic properties, depending on the pH of the environment.

Formula: C₉H₁₇NO₂

InChI: InChI=1S/C9H17NO2/c1-8(7-9(11)12)10-5-3-2-4-6-10/h8H,2-7H2,1H3,(H,11,12)

InChI key: InChIKey=JTTZPHBCJGTUME-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(C)N1CCCCC1

Synonyms:

• β-Methyl-1-piperidinepropanoic acid
• 1-Piperidinepropanoic acid, β-methyl-
• 3-Piperidin-1-ylbutanoic acid