CAS 76464-51-2

1-Chloro-2-(1-methylethoxy)-4-nitrobenzene

Description:

1-Chloro-2-(1-methylethoxy)-4-nitrobenzene, with the CAS number 76464-51-2, is an organic compound characterized by its aromatic structure, which includes a nitro group and a chloro substituent on a benzene ring. The presence of the 1-methylethoxy group introduces an ether functionality, contributing to its overall chemical properties. This compound is typically a pale yellow to brown solid or liquid, depending on its purity and specific conditions. It is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic nature. The nitro group imparts electrophilic characteristics, making it a potential candidate for further chemical reactions, such as nucleophilic substitutions. Additionally, the chloro substituent can participate in various chemical transformations, enhancing its utility in synthetic organic chemistry. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 1-Chloro-2-(1-methylethoxy)-4-nitrobenzene is a versatile compound with applications in chemical synthesis and research.

Formula: C₉H₁₀ClNO₃

InChI: InChI=1S/C9H10ClNO3/c1-6(2)14-9-5-7(11(12)13)3-4-8(9)10/h3-6H,1-2H3

InChI key: InChIKey=QKZLSNHQKFSBBJ-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=CC(N(=O)=O)=CC=C1Cl

Synonyms:

• Benzene, 1-chloro-2-(1-methylethoxy)-4-nitro-
• 1-Chloro-4-nitro-2-propan-2-yloxybenzene
• 1-Chloro-2-(1-methylethoxy)-4-nitrobenzene
• 1-Chloro-2-isopropoxy-4-nitrobenzene
• 1-Chloro-4-nitro-2-(propan-2-yloxy)benzene

1-Chloro-2-isopropoxy-4-nitrobenzene

CAS: 76464-51-2

Formula: C₉H₁₀ClNO₃

Molecular weight: 215.6336

Ref: IN-DA005XW3