CAS 764648-43-3

2,4,5-Trifluorobenzenecarboximidamide

Description:

2,4,5-Trifluorobenzenecarboximidamide is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with three fluorine atoms at the 2, 4, and 5 positions, along with a carboximidamide functional group. This compound is notable for its potential applications in medicinal chemistry and material science due to the presence of fluorine, which can enhance biological activity and influence the physical properties of the compound. The trifluoromethyl groups contribute to its lipophilicity and stability, making it an interesting candidate for various chemical reactions and synthesis pathways. Additionally, the presence of the carboximidamide group may impart specific reactivity, allowing for interactions with biological targets or other chemical species. As with many fluorinated compounds, 2,4,5-Trifluorobenzenecarboximidamide may exhibit unique solubility and volatility characteristics, which are important for its handling and application in research and industry. Safety data and handling precautions should be considered due to the potential toxicity associated with fluorinated compounds.

Formula: C₇H₅F₃N₂

InChI: InChI=1S/C7H5F3N2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H3,11,12)

InChI key: InChIKey=JXGCBKPKCDTSGD-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=C(F)C=C(F)C(F)=C1

2,4,5-trifluorobenzene-1-carboximidamide

CAS: 764648-43-3

Formula: C₇H₅F₃N₂

Molecular weight: 174.1232

Ref: IN-DA00G48R

2,4,5-Trifluorobenzene-1-carboximidamide

CAS: 764648-43-3

2,4,5-Trifluorobenzene-1-carboximidamide

Molecular weight: 174.12321g/mol

Ref: 54-PC106907

2,4,5-Trifluorobenzamidine hydrochloride

CAS: 764648-43-3

Formula: C₇H₆ClF₃N₂

Purity: 95.0%

Molecular weight: 210.58

Ref: 10-F493650