CAS 764650-43-3
:2-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2-tetradeuterio-ethanol
Description:
2-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2-tetradeuterio-ethanol is a chemical compound characterized by its unique structure, which includes a tert-butyl group and a dimethylsilyl group attached to an ether functional group. The presence of tetradeuterio indicates that the ethanol moiety has been isotopically labeled with deuterium, which can be useful in various applications, including NMR spectroscopy and tracer studies. This compound is likely to exhibit properties typical of siloxanes and ethers, such as moderate polarity and solubility in organic solvents. The tert-butyl group contributes to steric hindrance, potentially influencing the compound's reactivity and interactions with other molecules. Additionally, the presence of deuterium can affect the vibrational frequencies in IR spectroscopy, making it a valuable tool for studying reaction mechanisms and molecular dynamics. Overall, this compound's unique characteristics make it a significant subject of interest in organic and medicinal chemistry, particularly in the development of new synthetic methodologies and analytical techniques.
Formula:C8H16D4O2Si
InChI:InChI=1/C8H20O2Si/c1-8(2,3)11(4,5)10-7-6-9/h9H,6-7H2,1-5H3/i6D2,7D2
SMILES:CC(C)(C)[Si](C)(C)OC(C(O)([2H])[2H])([2H])[2H]
Synonyms:- 2-tert-Butyldimethylsilyloxyethanol-d4
- tert-Butyldimethylsilylethylene glycol D4
- 2-(tert-ButyldiMethylsiloxy)ethyl-d4 alcohol
- [2H4]-2-tert-Butyldimethylsilyloxyethanol
- 2-[(tert-ButyldiMethylsilyl)oxy]-1-ethanol-d4
- [2H4]-tert-Butyldimethylsilylethylene glycol
- 2-[[(1,1-DiMethylethyl)diMethylsilyl]oxy]ethan-1,1,2,2-d4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-tert-Butyldimethylsilyloxyethanol-d4
CAS:Controlled Product<p>Applications 2-tert-Butyldimethylsilyloxyethanol-d4 (cas# 764650-43-3) is a compound useful in organic synthesis.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C8H16D4O2SiColor and Shape:NeatMolecular weight:180.35
