CAS 764651-75-4

3-Methoxy-N-propylbenzenemethanamine

Description:

3-Methoxy-N-propylbenzenemethanamine, identified by its CAS number 764651-75-4, is an organic compound characterized by its structure, which includes a methoxy group (-OCH3) and a propylamine side chain attached to a benzene ring. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the methoxy group may enhance its lipophilicity, potentially affecting its biological activity and interaction with various receptors. Additionally, the compound may participate in various chemical reactions, including alkylation and acylation, due to the reactivity of the amine group. Its specific applications and biological effects would depend on its interaction with biological systems, which could include roles in medicinal chemistry or as a precursor in synthetic pathways. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₁H₁₇NO

InChI: InChI=1S/C11H17NO/c1-3-7-12-9-10-5-4-6-11(8-10)13-2/h4-6,8,12H,3,7,9H2,1-2H3

InChI key: InChIKey=UDBXJQKNGYJALH-UHFFFAOYSA-N

SMILES: C(NCCC)C1=CC(OC)=CC=C1

Synonyms:

• 3-Methoxy-N-propylbenzenemethanamine
• [(3-Methoxyphenyl)methyl](propyl)amine
• benzenemethanamine, 3-methoxy-N-propyl-