CAS 76466-24-5
:(5R,6E)-3-{(R)-[(E)-2-(acetylamino)ethenyl]sulfinyl}-6-(1-hydroxypropan-2-ylidene)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
Description:
The chemical substance with the name "(5R,6E)-3-{(R)-[(E)-2-(acetylamino)ethenyl]sulfinyl}-6-(1-hydroxypropan-2-ylidene)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid" and CAS number "76466-24-5" is a complex organic compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring system, indicating it is a bicyclic amine. The presence of multiple functional groups, such as a carboxylic acid, sulfinyl group, and an acetylamino moiety, suggests potential biological activity, possibly as a pharmaceutical agent. The stereochemistry indicated by the (R) and (E) designations implies specific spatial arrangements of atoms, which can significantly influence the compound's reactivity and interaction with biological targets. Additionally, the compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the presence of reactive functional groups. Overall, this compound's unique structural features and functional groups may contribute to its potential applications in medicinal chemistry or as a synthetic intermediate.
Formula:C14H16N2O6S
InChI:InChI=1/C14H16N2O6S/c1-7(6-17)11-9-5-10(23(22)4-3-15-8(2)18)12(14(20)21)16(9)13(11)19/h3-4,9,17H,5-6H2,1-2H3,(H,15,18)(H,20,21)/b4-3+,11-7+/t9-,23-/m1/s1
Synonyms:- Asparenomycin A
- 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[(R)-[(1E)-2-(acetylamino)ethenyl]sulfinyl]-6-(2-hydroxy-1-methylethylidene)-7-oxo-, (5R,6E)-
- asparenomycin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Asparenomycin A
CAS:Asparenomycin A is a carbapenem-class antibiotic known for its potent β-lactamase inhibitory activity.Formula:C14H16N2O6SColor and Shape:SolidMolecular weight:340.352
