CAS 764661-25-8

2-Pyrrolidinone, 3-(3-pyridinyl-2,4,5,6-d4-carbonyl)-

Description:

2-Pyrrolidinone, 3-(3-pyridinyl-2,4,5,6-d4-carbonyl)-, identified by its CAS number 764661-25-8, is a chemical compound that features a pyrrolidinone ring, which is a five-membered lactam. This compound is characterized by the presence of a pyridine moiety, which contributes to its aromatic properties and potential biological activity. The deuterated carbonyl group indicates that certain hydrogen atoms in the structure have been replaced with deuterium, enhancing its stability and altering its spectroscopic properties. This modification can be useful in various applications, including tracer studies in metabolic research. The compound may exhibit specific solubility characteristics depending on the solvent used, and its reactivity can be influenced by the functional groups present. Overall, 2-Pyrrolidinone derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their unique structural features and biological activities.

Formula: C₁₀H₆D₄N₂O₂

InChI: InChI=1S/C10H10N2O2/c13-9(7-2-1-4-11-6-7)8-3-5-12-10(8)14/h1-2,4,6,8H,3,5H2,(H,12,14)/i1D,2D,4D,6D

InChI key: InChIKey=PFGRGKSTHPJNLQ-QSHLYVKESA-N

SMILES: C(=O)(C1C(=O)NCC1)C=2C(=C(C(=NC2[2H])[2H])[2H])[2H]

Synonyms:

• 2-Pyrrolidinone, 3-(3-pyridinyl-2,4,5,6-d4-carbonyl)-

3-(Nicotinoyl-2,4,5,6-d4)-2-pyrrolidinone

Controlled Product

CAS: 764661-25-8

Applications 3-(Nicotinoyl-2,4,5,6-d4)-2-pyrrolidinone (cas# 764661-25-8 ) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₁₀₂H₄H₆N₂O₂

Color and Shape: Neat

Molecular weight: 194.22

Ref: TR-N431575