CAS 7647-63-4
:N-Hydroxyethylpromethazine
Description:
N-Hydroxyethylpromethazine is a chemical compound that belongs to the class of phenothiazines, which are primarily known for their use as antipsychotic medications. This substance is characterized by its structural features, including a phenothiazine core with a hydroxyethyl side chain. It exhibits properties typical of phenothiazines, such as antihistaminic, antiemetic, and sedative effects, making it useful in various therapeutic applications. The compound is typically a solid at room temperature and is soluble in organic solvents, which facilitates its use in pharmaceutical formulations. Its mechanism of action involves antagonism of dopamine and histamine receptors, contributing to its sedative and anti-allergic properties. Safety and handling precautions are essential, as with many chemical substances, due to potential side effects and interactions. As with any pharmaceutical compound, its use should be guided by medical professionals, considering the specific therapeutic context and patient needs.
Formula:C19H25N2OS
InChI:InChI=1S/C19H25N2OS/c1-15(21(2,3)12-13-22)14-20-16-8-4-6-10-18(16)23-19-11-7-5-9-17(19)20/h4-11,15,22H,12-14H2,1-3H3/q+1
InChI key:InChIKey=PDSVTRQOBUIQBQ-UHFFFAOYSA-N
SMILES:C(C([N+](CCO)(C)C)C)N1C=2C(SC=3C1=CC=CC3)=CC=CC2
Synonyms:- 10H-Phenothiazine-10-ethanaminium, N-(2-hydroxyethyl)-N,N,alpha-trimethyl-
- 10H-Phenothiazine-10-ethanaminium, N-(2-hydroxyethyl)-N,N,α-trimethyl-
- Ammonium, (2-hydroxyethyl)dimethyl(1-methyl-2-phenothiazin-10-ylethyl)-
- N-(2-Hydroxyethyl)-N,N,α-trimethyl-10H-phenothiazine-10-ethanaminium
- N-Hydroxyethylpromethazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.