CAS 764708-27-2
:2-(2-methoxy-4-pyridyl)ethanamine
Description:
2-(2-Methoxy-4-pyridyl)ethanamine, identified by its CAS number 764708-27-2, is an organic compound characterized by its pyridine ring and an ethylamine side chain. This compound features a methoxy group attached to the pyridine, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the pyridine ring imparts basicity to the molecule, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the methoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound is of interest in medicinal chemistry and pharmacology, as derivatives of pyridine and amine structures often exhibit significant biological activity, including potential applications in treating neurological disorders. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H12N2O
InChI:InChI=1/C8H12N2O/c1-11-8-6-7(2-4-9)3-5-10-8/h3,5-6H,2,4,9H2,1H3
SMILES:COc1cc(CCN)ccn1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
