CAS 764710-12-5
:5-(3-Bromo-4-methoxyphenyl)-2-thiazolamine
Description:
5-(3-Bromo-4-methoxyphenyl)-2-thiazolamine is an organic compound characterized by its thiazole and aromatic functionalities. The presence of a thiazole ring contributes to its potential biological activity, often associated with compounds that exhibit antimicrobial or anticancer properties. The bromo and methoxy substituents on the phenyl ring enhance its reactivity and solubility in organic solvents, which can influence its pharmacokinetic properties. This compound may be utilized in medicinal chemistry for the development of new therapeutic agents, particularly due to the structural diversity provided by the thiazole and aromatic systems. Additionally, the specific arrangement of substituents can affect its interaction with biological targets, making it a subject of interest in drug discovery. As with many thiazole derivatives, it may also exhibit interesting electronic properties, which can be leveraged in various applications, including materials science and organic electronics. Safety and handling precautions should be observed due to the presence of bromine, which can pose health risks.
Formula:C10H9BrN2OS
InChI:InChI=1S/C10H9BrN2OS/c1-14-8-3-2-6(4-7(8)11)9-5-13-10(12)15-9/h2-5H,1H3,(H2,12,13)
InChI key:InChIKey=KTJSFYVQBBUNDF-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=CC1OC)C=2SC(N)=NC2
Synonyms:- 2-Thiazolamine, 5-(3-bromo-4-methoxyphenyl)-
- 5-(3-Bromo-4-methoxyphenyl)-2-thiazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(3-Bromo-4-methoxyphenyl)thiazol-2-ylamine
CAS:Formula:C10H9BrN2OSColor and Shape:SolidMolecular weight:285.16
