CAS 764710-29-4

[5-(3-aminophenyl)furan-2-yl]methanol

Description:

[5-(3-aminophenyl)furan-2-yl]methanol, with the CAS number 764710-29-4, is an organic compound characterized by its furan and amino phenyl functional groups. This compound features a furan ring, which is a five-membered aromatic heterocycle containing oxygen, and a methanol group (-CH2OH) that contributes to its reactivity and solubility in polar solvents. The presence of the amino group (-NH2) on the phenyl ring enhances its potential for hydrogen bonding and increases its polarity, making it more soluble in water compared to non-polar compounds. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of the amino group to participate in various biochemical interactions. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the furan and phenyl moieties. Overall, [5-(3-aminophenyl)furan-2-yl]methanol is a versatile compound with potential utility in various chemical and biological applications.

Formula: C₁₁H₁₁NO₂

InChI: InChI=1/C11H11NO2/c12-9-3-1-2-8(6-9)11-5-4-10(7-13)14-11/h1-6,13H,7,12H2

SMILES: c1cc(cc(c1)N)c1ccc(CO)o1

Synonyms:

• [5-(3-Aminophenyl)-2-furyl]methanol
• 2-Furanmethanol, 5-(3-aminophenyl)-