CAS 76472-28-1

4-(Aminosulfonyl)phenyl 4-[(aminoiminomethyl)amino]benzoate

Description:

4-(Aminosulfonyl)phenyl 4-[(aminoiminomethyl)amino]benzoate, with the CAS number 76472-28-1, is a chemical compound that features a complex structure characterized by the presence of both sulfonamide and amino groups. This compound typically exhibits properties associated with its functional groups, such as potential solubility in polar solvents and the ability to form hydrogen bonds, which can influence its reactivity and interaction with biological systems. The sulfonamide group may impart antibacterial properties, while the amino groups can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound's structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, its stability and reactivity can be influenced by pH and temperature, making it essential to consider these factors in practical applications. Overall, this compound represents a unique combination of functional groups that may offer diverse applications in both research and industry.

Formula: C₁₄H₁₄N₄O₄S

InChI: InChI=1S/C14H14N4O4S/c15-14(16)18-10-3-1-9(2-4-10)13(19)22-11-5-7-12(8-6-11)23(17,20)21/h1-8H,(H4,15,16,18)(H2,17,20,21)

InChI key: InChIKey=YFUQTMNUQVFBBS-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(S(N)(=O)=O)C=C1)(=O)C2=CC=C(NC(=N)N)C=C2

Synonyms:

• 4-(Aminosulfonyl)phenyl 4-[(aminoiminomethyl)amino]benzoate
• Benzoic acid, 4-[(aminoiminomethyl)amino]-, 4-(aminosulfonyl)phenyl ester

Ono 3307 Free Base

CAS: 76472-28-1

Ono 3307 Free Base is a new synthetic protease inhibitor

Formula: C₁₄H₁₄N₄O₄S

Color and Shape: Solid

Molecular weight: 334.35

Ref: TM-T68733