CAS 76472-88-3
:Morachalcone A
Description:
Morachalcone A is a natural compound classified as a chalcone, which is a type of flavonoid. It is primarily derived from the Moraceae family of plants, particularly those in the genus Morus. This compound is characterized by its yellow crystalline appearance and exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties. Morachalcone A has been studied for its ability to modulate various cellular pathways, making it of interest in pharmacological research. Its chemical structure features a typical chalcone backbone, consisting of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. This structural motif is crucial for its biological activity, as it allows for interactions with various biological targets. Additionally, Morachalcone A's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in its application in research and potential therapeutic uses. Overall, Morachalcone A represents a promising compound in the field of natural product chemistry and medicinal research.
Formula:C20H20O5
InChI:InChI=1S/C20H20O5/c1-12(2)3-7-15-18(23)10-8-16(20(15)25)17(22)9-5-13-4-6-14(21)11-19(13)24/h3-6,8-11,21,23-25H,7H2,1-2H3/b9-5+
InChI key:InChIKey=NXBYIJSAISXPKJ-WEVVVXLNSA-N
SMILES:C(/C=C/C1=C(O)C=C(O)C=C1)(=O)C2=C(O)C(CC=C(C)C)=C(O)C=C2
Synonyms:- 2-Propen-1-one, 1-[2,4-dihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-3-(2,4-dihydroxyphenyl)-, (2E)-
- 2-Propen-1-one, 1-[2,4-dihydroxy-3-(3-methyl-2-butenyl)phenyl]-3-(2,4-dihydroxyphenyl)-, (E)-
- Morachalcone A
- (2E)-1-[2,4-Dihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-3-(2,4-dihydroxyphenyl)-2-propen-1-one
- 2-Propen-1-one, 1-[2,4-dihydroxy-3-(3-methyl-2-butenyl)phenyl]-3-(2,4-dihydroxyphenyl)-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2E)-1-[2,4-Dihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-3-(2,4-dihydroxyphenyl)-2-propen-1-one
CAS:Formula:C20H20O5Molecular weight:340.3698Morachalcone A
CAS:Morachalcone A inhibits tyrosinase (IC50: 0.013 uM), pancreatic lipase (IC50: 6.2 uM), NO production (IC50: 16.4 uM), and protects neurons (EC50: 35.5 uM).Formula:C20H20O5Purity:97.00%Color and Shape:SolidMolecular weight:340.37Morachalcone A
CAS:Formula:C20H20O5Purity:95%~99%Color and Shape:Yellow powderMolecular weight:340.375Morachalcone A
CAS:Morachalcone A is a naturally occurring chalcone, which is isolated predominantly from members of the Morus species, particularly in the root bark. As a prenylated chalcone, its structure allows it to exhibit significant biological activities through a variety of modes of action. Morachalcone A primarily acts through the modulation of various cell signaling pathways, influencing inflammatory and oxidative stress responses. Its unique chemical structure allows it to inhibit enzymes such as cyclooxygenase and lipoxygenase, as well as downregulating pro-inflammatory cytokines.Formula:C20H20O5Purity:Min. 95%Molecular weight:340.4 g/mol



