CAS 76475-32-6

2-Butanone, 3-(acetyloxy)-1-[2-[3-(3-furanyl)-1-oxopropyl]-2,6,6-trimethylcyclohexyl]-, [1S-[1α(S*),2β]]-

Description:

2-Butanone, 3-(acetyloxy)-1-[2-[3-(3-furanyl)-1-oxopropyl]-2,6,6-trimethylcyclohexyl]-, with the CAS number 76475-32-6, is a complex organic compound characterized by its multi-functional structure. It features a butanone backbone, which is a ketone, indicating the presence of a carbonyl group (C=O) within its molecular framework. The compound also contains an acetyloxy group, suggesting it has ester characteristics, which can influence its reactivity and solubility. The presence of a furanyl group indicates potential aromatic properties, contributing to its stability and reactivity in various chemical environments. Additionally, the trimethylcyclohexyl moiety suggests steric hindrance, which may affect the compound's physical properties, such as boiling point and solubility. Overall, this compound's unique structure may impart specific biological activities or applications in fields such as pharmaceuticals or agrochemicals, although detailed studies would be necessary to elucidate its full range of characteristics and potential uses.

Formula: C₂₂H₃₂O₅

InChI: InChI=1S/C22H32O5/c1-15(27-16(2)23)18(24)13-19-21(3,4)10-6-11-22(19,5)20(25)8-7-17-9-12-26-14-17/h9,12,14-15,19H,6-8,10-11,13H2,1-5H3/t15-,19+,22+/m1/s1

InChI key: InChIKey=KMEPKEFHJNCARE-MPHOGZCYSA-N

SMILES: C(C([C@H](OC(C)=O)C)=O)[C@@H]1[C@](C(CCC=2C=COC2)=O)(C)CCCC1(C)C

Synonyms:

• 2-Butanone, 3-(acetyloxy)-1-[2-[3-(3-furanyl)-1-oxopropyl]-2,6,6-trimethylcyclohexyl]-, [1S-[1α(S*),2β]]-

2-Butanone, 3-(acetyloxy)-1-[2-[3-(3-furanyl)-1-oxopropyl]-2,6,6-trimethylcyclohexyl]-, [1S-[1α(S*),2β]]-

CAS: 76475-32-6

Formula: C₂₂H₃₂O₅

Purity: 98.0%

Molecular weight: 376.4865

Ref: IN-DA01SNVD

(R)-3β-Hydroxy steroid sulfotransferase-IN-11

CAS: 76475-32-6

(R)-3β-Hydroxy steroid sulfotransferase-IN-11 has a wide range of applications in life science related research.

Formula: C₂₂H₃₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 376.49

Ref: TM-TN3270

8-Acetoxy-15,16-epoxy-8,9-secolabda-13(16),14-diene-7,9-dione

CAS: 76475-32-6

8-Acetoxy-15,16-epoxy-8,9-secolabda-13(16),14-diene-7,9-dione is a diterpenoid compound, which is structurally characterized by its complex tricyclic architecture and distinctive functional groups. This compound is typically isolated from natural sources, notably certain plant species within the Lauraceae family. These plants have been traditionally used in various medicinal contexts, and the compound is often extracted using sophisticated chromatographic techniques.

Formula: C₂₂H₃₂O₅

Purity: Min. 95%

Molecular weight: 376.5 g/mol

Ref: 3D-BDA47532