CAS 76475-61-1

4-[(2-Hydroxyphenyl)amino]-4-oxobutanoic acid

Description:

4-[(2-Hydroxyphenyl)amino]-4-oxobutanoic acid, also known by its CAS number 76475-61-1, is an organic compound characterized by its functional groups, which include an amino group, a hydroxyl group, and a ketone. This compound features a butanoic acid backbone, with a phenolic substitution that enhances its reactivity and solubility in polar solvents. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the amino group can act as a nucleophile in various chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways. Its structural features suggest potential applications in medicinal chemistry, where modifications can lead to derivatives with enhanced efficacy or reduced toxicity. Additionally, the compound's stability and reactivity can be influenced by pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₁₀H₁₁NO₄

InChI: InChI=1S/C10H11NO4/c12-8-4-2-1-3-7(8)11-9(13)5-6-10(14)15/h1-4,12H,5-6H2,(H,11,13)(H,14,15)

InChI key: InChIKey=KHPAYIYVNRVFCK-UHFFFAOYSA-N

SMILES: N(C(CCC(O)=O)=O)C1=C(O)C=CC=C1

Synonyms:

• 4-[(2-Hydroxyphenyl)amino]-4-oxobutanoic acid
• 3-[(2-Hydroxyphenyl)carbamoyl]propanoic acid
• Butanoic acid, 4-[(2-hydroxyphenyl)amino]-4-oxo-