CAS 76481-38-4
:3-Chloro-α,α-diethylbenzenemethanol
Description:
3-Chloro-α,α-diethylbenzenemethanol is an organic compound characterized by its chlorinated aromatic structure and alcohol functional group. It features a benzene ring substituted with two ethyl groups and a chlorine atom at the meta position relative to the hydroxymethyl group. This compound is typically a colorless to pale yellow liquid with a distinctive odor. Its molecular structure contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. The presence of the chlorine atom enhances its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which can be of interest in fields such as pharmaceuticals or agrochemicals. Safety data sheets should be consulted for handling and toxicity information, as chlorinated compounds can pose environmental and health risks. Overall, 3-Chloro-α,α-diethylbenzenemethanol is a notable compound in organic chemistry with potential applications in various chemical industries.
Formula:C11H15ClO
InChI:InChI=1S/C11H15ClO/c1-3-11(13,4-2)9-6-5-7-10(12)8-9/h5-8,13H,3-4H2,1-2H3
InChI key:InChIKey=ALFDNQGIFYDTJW-UHFFFAOYSA-N
SMILES:C(CC)(CC)(O)C1=CC(Cl)=CC=C1
Synonyms:- 3-Chloro-α,α-diethylbenzenemethanol
- Benzenemethanol, 3-chloro-α,α-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.