CAS 76487-51-9
:5-(acetylamino)-9-azido-3,5,9-trideoxy-D-glycero-D-galacto-non-2-ulosonic acid
Description:
5-(Acetylamino)-9-azido-3,5,9-trideoxy-D-glycero-D-galacto-non-2-ulosonic acid, with the CAS number 76487-51-9, is a synthetic derivative of sialic acid, characterized by the presence of an azido group and an acetylamino group. This compound typically exhibits properties associated with sialic acids, such as being a negatively charged molecule at physiological pH, which can influence its interactions with proteins and cell membranes. The azido group allows for potential applications in bioconjugation and labeling, making it useful in biochemical research and drug development. The presence of the acetylamino group may enhance its solubility and stability in biological systems. Additionally, the structural features of this compound suggest it may play a role in modulating biological processes, such as cell signaling and pathogen recognition. Overall, its unique functional groups and structural characteristics make it a valuable compound for various applications in the fields of biochemistry and medicinal chemistry.
Formula:C11H18N4O8
InChI:InChI=1/C11H18N4O8/c1-4(16)14-8(5(17)2-6(18)11(22)23)10(21)9(20)7(19)3-13-15-12/h5,7-10,17,19-21H,2-3H2,1H3,(H,14,16)(H,22,23)/t5-,7+,8+,9+,10+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
9AzNue5Ac
CAS:9AzNue5Ac is a Neu5Ac analog that is metabolized in vivo in living cells and in mice.9AzNue5Ac binds to sialoglycans.
Formula:C11H18N4O8Purity:≥98%Color and Shape:SolidMolecular weight:334.28N-Acetyl-9-azido-9-deoxyneuraminic Acid
CAS:Formula:C11H18N4O8Purity:min. 95.0 area%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:334.29N-Acetyl-9-azido-9-deoxy-neuraminic acid
CAS:Formula:C11H18N4O8Purity:≥ 90.0%Color and Shape:Beige amorphous solidMolecular weight:334.28N-Acetyl-9-azido-9-deoxy-neuraminic acid
CAS:N-Acetyl-9-azido-9-deoxy-neuraminic acidColor and Shape:SolidMolecular weight:334.28g/molN-Acetyl-9-azido-9-deoxy-neuraminic acid
CAS:N-Acetyl-9-azido-9-deoxy-neuraminic acid (also known as 9AzNeu5Ac) is used as a sialic acid substitute for metabolic glycan labelling, which allows glycan-protein interactions and sialylations to be interrogated. Naturally occurring glycans can be di-sialylated by sialidase and replaced by a sialyl analogue, such as N-acetyl-9-azido-9-deoxy-neuraminic acid, using sialyltransferase. The modified glycans are then resistant to sialidase. Reduction of the azide functionality of N-acetyl-9-azido-9-deoxy-neuraminic acid affords access to an additional 9-amino sialic acid analogue which can be further elaborated to 9-amido analogues.Formula:C11H18N4O8Purity:Min. 90 Area-%Color and Shape:Off-White PowderMolecular weight:334.28 g/molN-Acetyl-9-azido-9-deoxyneuraminic Acid
CAS:Controlled ProductFormula:C11H18N4O8Color and Shape:NeatMolecular weight:334.283





