CAS 76487-51-9

5-(acetylamino)-9-azido-3,5,9-trideoxy-D-glycero-D-galacto-non-2-ulosonic acid

Description:

5-(Acetylamino)-9-azido-3,5,9-trideoxy-D-glycero-D-galacto-non-2-ulosonic acid, with the CAS number 76487-51-9, is a synthetic derivative of sialic acid, characterized by the presence of an azido group and an acetylamino group. This compound typically exhibits properties associated with sialic acids, such as being a negatively charged molecule at physiological pH, which can influence its interactions with proteins and cell membranes. The azido group allows for potential applications in bioconjugation and labeling, making it useful in biochemical research and drug development. The presence of the acetylamino group may enhance its solubility and stability in biological systems. Additionally, the structural features of this compound suggest it may play a role in modulating biological processes, such as cell signaling and pathogen recognition. Overall, its unique functional groups and structural characteristics make it a valuable compound for various applications in the fields of biochemistry and medicinal chemistry.

Formula: C₁₁H₁₈N₄O₈

InChI: InChI=1/C11H18N4O8/c1-4(16)14-8(5(17)2-6(18)11(22)23)10(21)9(20)7(19)3-13-15-12/h5,7-10,17,19-21H,2-3H2,1H3,(H,14,16)(H,22,23)/t5-,7+,8+,9+,10+/m0/s1

9AzNue5Ac

CAS: 76487-51-9

9AzNue5Ac is a Neu5Ac analog that is metabolized in vivo in living cells and in mice.9AzNue5Ac binds to sialoglycans.

Formula: C₁₁H₁₈N₄O₈

Purity: ≥98%

Color and Shape: Solid

Molecular weight: 334.28

Ref: TM-T74989

9AzNue5Ac

CAS: 76487-51-9

9AzNue5Ac

Purity: ≥90%

Molecular weight: 334.28g/mol

Ref: 54-BUP00473

N-Acetyl-9-azido-9-deoxyneuraminic Acid

CAS: 76487-51-9

Formula: C₁₁H₁₈N₄O₈

Purity: min. 95.0 area%(HPLC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 334.29

Ref: 3B-A3458

N-Acetyl-9-azido-9-deoxy-neuraminic acid

CAS: 76487-51-9

Formula: C₁₁H₁₈N₄O₈

Purity: ≥ 90.0%

Color and Shape: Beige amorphous solid

Molecular weight: 334.28

Ref: 7W-GC7526

N-Acetyl-9-azido-9-deoxy-neuraminic acid

CAS: 76487-51-9

N-Acetyl-9-azido-9-deoxy-neuraminic acid

Color and Shape: Solid

Molecular weight: 334.28g/mol

Ref: 54-BICL2086

N-Acetyl-9-azido-9-deoxy-neuraminic acid

CAS: 76487-51-9

N-Acetyl-9-azido-9-deoxy-neuraminic acid (also known as 9AzNeu5Ac) is used as a sialic acid substitute for metabolic glycan labelling, which allows glycan-protein interactions and sialylations to be interrogated. Naturally occurring glycans can be di-sialylated by sialidase and replaced by a sialyl analogue, such as N-acetyl-9-azido-9-deoxy-neuraminic acid, using sialyltransferase. The modified glycans are then resistant to sialidase. Reduction of the azide functionality of N-acetyl-9-azido-9-deoxy-neuraminic acid affords access to an additional 9-amino sialic acid analogue which can be further elaborated to 9-amido analogues.

Formula: C₁₁H₁₈N₄O₈

Purity: Min. 90 Area-%

Color and Shape: Off-White Powder

Molecular weight: 334.28 g/mol

Ref: 3D-MA30919

N-Acetyl-9-azido-9-deoxyneuraminic Acid

Controlled Product

CAS: 76487-51-9

Formula: C₁₁H₁₈N₄O₈

Color and Shape: Neat

Molecular weight: 334.283

Ref: TR-A795620