CAS 76495-24-4

4,5-Dihydro-N-(1-methylethyl)-2-thiazolamine

Description:

4,5-Dihydro-N-(1-methylethyl)-2-thiazolamine, with the CAS number 76495-24-4, is a chemical compound that belongs to the thiazole family, characterized by a five-membered ring containing both sulfur and nitrogen atoms. This compound typically exhibits properties associated with thiazole derivatives, such as potential biological activity and reactivity due to the presence of the thiazole ring. The presence of the isopropyl group (1-methylethyl) in its structure may influence its solubility and interaction with biological systems. Thiazole derivatives are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its specific applications and behavior in biological systems would depend on further studies, including its stability, reactivity, and interaction with other molecules. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₆H₁₂N₂S

InChI: InChI=1S/C6H12N2S/c1-5(2)8-6-7-3-4-9-6/h5H,3-4H2,1-2H3,(H,7,8)

InChI key: InChIKey=QDWGKCWXXKFJBD-UHFFFAOYSA-N

SMILES: N(C(C)C)C1=NCCS1

Synonyms:

• 2-Thiazolamine, 4,5-dihydro-N-(1-methylethyl)-
• 4,5-Dihydro-N-(1-methylethyl)-2-thiazolamine