CAS 76498-22-1
:(aR,bS)-rel-alpha-Hydroxy-beta-[[(phenylmethoxy)carbonyl]amino]benzenebutanoic acid
Description:
The chemical substance known as (aR,bS)-rel-alpha-Hydroxy-beta-[[(phenylmethoxy)carbonyl]amino]benzenebutanoic acid, with the CAS number 76498-22-1, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features an alpha-hydroxy group, which contributes to its potential as a chiral molecule, and a beta-amino acid structure, indicating its relevance in biochemical applications. The presence of a phenylmethoxycarbonyl group suggests that it may be used in peptide synthesis or as a protecting group in organic synthesis. This compound is likely to exhibit solubility in polar solvents due to the hydroxyl and amino functionalities, while its aromatic components may provide hydrophobic characteristics. Additionally, the stereochemical configuration (aR, bS) implies that it may have distinct biological activities or interactions, making it of interest in medicinal chemistry and drug development. Overall, its unique structure and properties position it as a valuable compound in various chemical and pharmaceutical applications.
Formula:C18H19NO5
InChI:InChI=1/C18H19NO5/c20-16(17(21)22)15(11-13-7-3-1-4-8-13)19-18(23)24-12-14-9-5-2-6-10-14/h1-10,15-16,20H,11-12H2,(H,19,23)(H,21,22)/t15-,16+/m1/s1
Synonyms:- Z-Ahpa
- (2S,3R)-3-{[(benzyloxy)carbonyl]amino}-2-hydroxy-4-phenylbutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.