CAS 765-71-9
:2,5-dimethyl-1H-pyrrol-1-amine
Description:
2,5-Dimethyl-1H-pyrrol-1-amine, with the CAS number 765-71-9, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features two methyl groups attached to the second and fifth carbon atoms of the pyrrole ring, as well as an amino group (-NH2) at the first position. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group makes it a basic compound, capable of forming salts with acids. 2,5-Dimethyl-1H-pyrrol-1-amine is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential as a building block for more complex molecules. Its reactivity is influenced by the electron-rich nature of the pyrrole ring, allowing for various chemical transformations. Safety data should be consulted for handling, as with many amines, it may pose health risks if not managed properly.
Formula:C6H10N2
InChI:InChI=1/C6H10N2/c1-5-3-4-6(2)8(5)7/h3-4H,7H2,1-2H3
SMILES:Cc1ccc(C)n1N
Synonyms:- Pyrrole, 2,5-dimethyl-N-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.