CAS 765-79-7

1-Ethyl-2-methylpyrrolidine

Description:

1-Ethyl-2-methylpyrrolidine is a cyclic organic compound characterized by a five-membered ring structure containing nitrogen. It is classified as a secondary amine due to the presence of two alkyl groups attached to the nitrogen atom. The compound exhibits a molecular formula that reflects its composition of carbon, hydrogen, and nitrogen atoms. Typically, it is a colorless to pale yellow liquid with a distinctive amine-like odor. Its physical properties include a moderate boiling point and solubility in organic solvents, while being less soluble in water. 1-Ethyl-2-methylpyrrolidine is known for its potential applications in organic synthesis and as a solvent or reagent in various chemical reactions. Additionally, it may exhibit basic properties due to the nitrogen atom, allowing it to participate in protonation reactions. Safety considerations should be taken into account, as it may pose health risks upon exposure. Overall, this compound is of interest in both industrial and research settings for its unique chemical properties and reactivity.

Formula: C₇H₁₅N

InChI: InChI=1S/C7H15N/c1-3-8-6-4-5-7(8)2/h7H,3-6H2,1-2H3

InChI key: InChIKey=JKNXMPSMAZUQMJ-UHFFFAOYSA-N

SMILES: C(C)N1C(C)CCC1

Synonyms:

• Pyrrolidine, 1-ethyl-2-methyl-
• 1-Ethyl-2-methylpyrrolidine

1-Ethyl-2-methylpyrrolidin

CAS: 765-79-7

Formula: C₇H₁₅N

Molecular weight: 113.20

Ref: 4Z-P-208056